Difference between revisions of "CPD-15016"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * common name: ** (4S)-4-hy...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C(=O)C([O-])=O)C(C([O-])=O)O | ** C(C(=O)C([O-])=O)C(C([O-])=O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 160.083 | ** 160.083 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L | ||
| + | * common name: | ||
| + | ** (4S)-4-hydroxy-2-oxoglutarate | ||
* Synonym(s): | * Synonym(s): | ||
** L-4-hydroxy-2-oxoglutarate | ** L-4-hydroxy-2-oxoglutarate | ||
| Line 19: | Line 19: | ||
* [[RXN-13990]] | * [[RXN-13990]] | ||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC71685 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337] | ||
{{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}} | {{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=160.083 }} | {{#set: molecular weight=160.083 }} | ||
| + | {{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}} | ||
| + | {{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}} | ||
{{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}} | {{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}} | ||
{{#set: reversible reaction associated=RXN-13990}} | {{#set: reversible reaction associated=RXN-13990}} | ||
Latest revision as of 13:07, 10 January 2019
Contents
Metabolite CPD-15016
- smiles:
- C(C(=O)C([O-])=O)C(C([O-])=O)O
- molecular weight:
- 160.083
- inchi key:
- InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
- common name:
- (4S)-4-hydroxy-2-oxoglutarate
- Synonym(s):
- L-4-hydroxy-2-oxoglutarate
- L-4-hydroxy-2-ketoglutarate
- (S)-2-hydroxy-4-oxopentanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(=O)C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.
