Difference between revisions of "CPD-11281"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * common...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 338.373 | ** 338.373 | ||
+ | * inchi key: | ||
+ | ** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M | ||
+ | * common name: | ||
+ | ** S-sulfanylglutathione | ||
* Synonym(s): | * Synonym(s): | ||
** GSSH | ** GSSH | ||
Line 18: | Line 18: | ||
* [[RXN-13161]] | * [[RXN-13161]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267] | ** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267] | ||
{{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | {{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=338.373 }} | {{#set: molecular weight=338.373 }} | ||
+ | {{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}} | ||
+ | {{#set: common name=S-sulfanylglutathione}} | ||
{{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}} | {{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}} | ||
{{#set: consumed by=FESGSHTHIO-RXN|RXN-13161}} | {{#set: consumed by=FESGSHTHIO-RXN|RXN-13161}} | ||
− | |||
− |
Latest revision as of 14:12, 10 January 2019
Contents
Metabolite CPD-11281
- smiles:
- C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- molecular weight:
- 338.373
- inchi key:
- InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
- common name:
- S-sulfanylglutathione
- Synonym(s):
- GSSH
- glutathione-sulfide
- glutathione persulfide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.