Difference between revisions of "CPD-4101"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * molecular weight: | ||
| + | ** 412.698 | ||
* inchi key: | * inchi key: | ||
** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N | ** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N | ||
* common name: | * common name: | ||
** 24-methylenelophenol | ** 24-methylenelophenol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 4α-methyl-5α-ergosta-7,24-dien-3β-ol | ** 4α-methyl-5α-ergosta-7,24-dien-3β-ol | ||
| Line 18: | Line 18: | ||
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]] | * [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522] | ** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522] | ||
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
{{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}} | {{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}} | ||
{{#set: common name=24-methylenelophenol}} | {{#set: common name=24-methylenelophenol}} | ||
| − | |||
{{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}} | {{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}} | ||
{{#set: consumed by=2.1.1.143-RXN}} | {{#set: consumed by=2.1.1.143-RXN}} | ||
{{#set: reversible reaction associated=RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.}} | {{#set: reversible reaction associated=RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.}} | ||
Latest revision as of 13:16, 10 January 2019
Contents
Metabolite CPD-4101
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 412.698
- inchi key:
- InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
- common name:
- 24-methylenelophenol
- Synonym(s):
- 4α-methyl-5α-ergosta-7,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
