Difference between revisions of "CPD-9956"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 729.137 | ** 729.137 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N | ||
+ | * common name: | ||
+ | ** ubiquinol-8 | ||
* Synonym(s): | * Synonym(s): | ||
** ubiquinol(8) | ** ubiquinol(8) | ||
Line 16: | Line 16: | ||
* [[DHHB-METHYLTRANSFER-RXN]] | * [[DHHB-METHYLTRANSFER-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[R00281]] | ||
* [[SUCDH_LPAREN_q8_RPAREN_m]] | * [[SUCDH_LPAREN_q8_RPAREN_m]] | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61682 61682] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61682 61682] | ||
− | * | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25074411 25074411] | ||
* HMDB : HMDB01060 | * HMDB : HMDB01060 | ||
+ | * BIGG : q8h2 | ||
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} | ||
− | |||
− | |||
{{#set: molecular weight=729.137 }} | {{#set: molecular weight=729.137 }} | ||
+ | {{#set: inchi key=InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N}} | ||
+ | {{#set: common name=ubiquinol-8}} | ||
{{#set: common name=ubiquinol(8)}} | {{#set: common name=ubiquinol(8)}} | ||
{{#set: produced by=DHHB-METHYLTRANSFER-RXN}} | {{#set: produced by=DHHB-METHYLTRANSFER-RXN}} | ||
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=R00281|SUCDH_LPAREN_q8_RPAREN_m}} |
Latest revision as of 13:17, 10 January 2019
Contents
Metabolite CPD-9956
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- molecular weight:
- 729.137
- inchi key:
- InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N
- common name:
- ubiquinol-8
- Synonym(s):
- ubiquinol(8)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links