Difference between revisions of "CPD-728"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-728 CPD-728] == * smiles: ** CCC=CC[CH]1(OC1=CC=CCCCCCCCC(=O)[O-]) * common name: ** (9Z,13...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC=CC[CH]1(OC1=CC=CCCCCCCCC(=O)[O-]) | ** CCC=CC[CH]1(OC1=CC=CCCCCCCCC(=O)[O-]) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 291.409 | ** 291.409 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YZBZORUZOSCZRN-DCUPSMFCSA-M | ||
| + | * common name: | ||
| + | ** (9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoate | ||
* Synonym(s): | * Synonym(s): | ||
** 12,13(S)-epoxylinolenic acid | ** 12,13(S)-epoxylinolenic acid | ||
| Line 24: | Line 24: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=134055 134055] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20843327 20843327] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20843327 20843327] | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04672 C04672] | ** [http://www.genome.jp/dbget-bin/www_bget?C04672 C04672] | ||
| + | * LIPID_MAPS : LMFA02000053 | ||
{{#set: smiles=CCC=CC[CH]1(OC1=CC=CCCCCCCCC(=O)[O-])}} | {{#set: smiles=CCC=CC[CH]1(OC1=CC=CCCCCCCCC(=O)[O-])}} | ||
| − | |||
| − | |||
{{#set: molecular weight=291.409 }} | {{#set: molecular weight=291.409 }} | ||
| + | {{#set: inchi key=InChIKey=YZBZORUZOSCZRN-DCUPSMFCSA-M}} | ||
| + | {{#set: common name=(9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoate}} | ||
{{#set: common name=12,13(S)-epoxylinolenic acid|epoxylinolenic acid|12,13-epoxy-octadecatrienoic acid|(9Z)-(13S)-12,13-epoxyoctadeca-9,11,15-trienoate|(9Z,15Z)-(13S)-12,13-epoxyoctadeca-9,11,15-trienoate|12,13-EOT|(9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoic acid|12,13(S)-epoxylinolenate}} | {{#set: common name=12,13(S)-epoxylinolenic acid|epoxylinolenic acid|12,13-epoxy-octadecatrienoic acid|(9Z)-(13S)-12,13-epoxyoctadeca-9,11,15-trienoate|(9Z,15Z)-(13S)-12,13-epoxyoctadeca-9,11,15-trienoate|12,13-EOT|(9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoic acid|12,13(S)-epoxylinolenate}} | ||
{{#set: produced by=RXN1F-19}} | {{#set: produced by=RXN1F-19}} | ||
Latest revision as of 13:25, 10 January 2019
Contents
Metabolite CPD-728
- smiles:
- CCC=CC[CH]1(OC1=CC=CCCCCCCCC(=O)[O-])
- molecular weight:
- 291.409
- inchi key:
- InChIKey=YZBZORUZOSCZRN-DCUPSMFCSA-M
- common name:
- (9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoate
- Synonym(s):
- 12,13(S)-epoxylinolenic acid
- epoxylinolenic acid
- 12,13-epoxy-octadecatrienoic acid
- (9Z)-(13S)-12,13-epoxyoctadeca-9,11,15-trienoate
- (9Z,15Z)-(13S)-12,13-epoxyoctadeca-9,11,15-trienoate
- 12,13-EOT
- (9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoic acid
- 12,13(S)-epoxylinolenate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CC[CH]1(OC1=CC=CCCCCCCCC(=O)[O-])" cannot be used as a page name in this wiki.
