Difference between revisions of "CPD-7246"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7246 CPD-7246] == * smiles: ** CC(NC1(C(O)C(O)C(CO)OC(OP([O-])(=O)[O-])1))=O * common name:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(NC1(C(O)C(O)C(CO)OC(OP([O-])(=O)[O-])1))=O | ** CC(NC1(C(O)C(O)C(CO)OC(OP([O-])(=O)[O-])1))=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 299.174 | ** 299.174 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FZLJPEPAYPUMMR-JAJWTYFOSA-L | ||
| + | * common name: | ||
| + | ** N-acetyl-α-D-galactosamine 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** N-Acetyl-D-galactosamine 1-phosphate | ** N-Acetyl-D-galactosamine 1-phosphate | ||
| Line 17: | Line 17: | ||
* [[RXN-13760]] | * [[RXN-13760]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61970 61970] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61970 61970] | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859685 49859685] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859685 49859685] | ||
| + | * HMDB : HMDB59626 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C18060 C18060] | ||
| + | * BIGG : acgal1p | ||
{{#set: smiles=CC(NC1(C(O)C(O)C(CO)OC(OP([O-])(=O)[O-])1))=O}} | {{#set: smiles=CC(NC1(C(O)C(O)C(CO)OC(OP([O-])(=O)[O-])1))=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=299.174 }} | {{#set: molecular weight=299.174 }} | ||
| + | {{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-JAJWTYFOSA-L}} | ||
| + | {{#set: common name=N-acetyl-α-D-galactosamine 1-phosphate}} | ||
{{#set: common name=N-Acetyl-D-galactosamine 1-phosphate}} | {{#set: common name=N-Acetyl-D-galactosamine 1-phosphate}} | ||
{{#set: reversible reaction associated=RXN-13760}} | {{#set: reversible reaction associated=RXN-13760}} | ||
Latest revision as of 13:29, 10 January 2019
Contents
Metabolite CPD-7246
- smiles:
- CC(NC1(C(O)C(O)C(CO)OC(OP([O-])(=O)[O-])1))=O
- molecular weight:
- 299.174
- inchi key:
- InChIKey=FZLJPEPAYPUMMR-JAJWTYFOSA-L
- common name:
- N-acetyl-α-D-galactosamine 1-phosphate
- Synonym(s):
- N-Acetyl-D-galactosamine 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(NC1(C(O)C(O)C(CO)OC(OP([O-])(=O)[O-])1))=O" cannot be used as a page name in this wiki.
