Difference between revisions of "UDP-4-AMINO-4-DEOXY-L-ARABINOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-4-AMINO-4-DEOXY-L-ARABINOSE UDP-4-AMINO-4-DEOXY-L-ARABINOSE] == * smiles: ** C(OP(=O)([O-])...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])OP(=O)([O-])OC1(OCC([N+])C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)) | ** C(OP(=O)([O-])OP(=O)([O-])OC1(OCC([N+])C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 534.286 | ** 534.286 | ||
+ | * inchi key: | ||
+ | ** InChIKey=GWBAKYBSWHQNMQ-IAZOVDBXSA-M | ||
+ | * common name: | ||
+ | ** UDP-4-amino-4-deoxy-β-L-arabinopyranose | ||
* Synonym(s): | * Synonym(s): | ||
** uridine 5''-diphospho-{β}-4-deoxy-4-amino-L-arabinose | ** uridine 5''-diphospho-{β}-4-deoxy-4-amino-L-arabinose | ||
Line 18: | Line 18: | ||
* [[RXN0-1863]] | * [[RXN0-1863]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58708 58708] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58708 58708] | ||
− | * | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201108 25201108] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16153 C16153] | ** [http://www.genome.jp/dbget-bin/www_bget?C16153 C16153] | ||
+ | * BIGG : udpLa4n | ||
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OCC([N+])C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}} | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OCC([N+])C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}} | ||
− | |||
− | |||
{{#set: molecular weight=534.286 }} | {{#set: molecular weight=534.286 }} | ||
+ | {{#set: inchi key=InChIKey=GWBAKYBSWHQNMQ-IAZOVDBXSA-M}} | ||
+ | {{#set: common name=UDP-4-amino-4-deoxy-β-L-arabinopyranose}} | ||
{{#set: common name=uridine 5''-diphospho-{β}-4-deoxy-4-amino-L-arabinose|UDP-4-amino-4-deoxy-L-arabinose}} | {{#set: common name=uridine 5''-diphospho-{β}-4-deoxy-4-amino-L-arabinose|UDP-4-amino-4-deoxy-L-arabinose}} | ||
{{#set: reversible reaction associated=RXN0-1863}} | {{#set: reversible reaction associated=RXN0-1863}} |
Latest revision as of 14:36, 10 January 2019
Contents
Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OC1(OCC([N+])C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
- molecular weight:
- 534.286
- inchi key:
- InChIKey=GWBAKYBSWHQNMQ-IAZOVDBXSA-M
- common name:
- UDP-4-amino-4-deoxy-β-L-arabinopyranose
- Synonym(s):
- uridine 5-diphospho-{β}-4-deoxy-4-amino-L-arabinose
- UDP-4-amino-4-deoxy-L-arabinose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OC1(OCC([N+])C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))" cannot be used as a page name in this wiki.
"uridine 5-diphospho-{β}-4-deoxy-4-amino-L-arabinose" cannot be used as a page name in this wiki.