Difference between revisions of "CPD-18890"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18890 CPD-18890] == * smiles: ** CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ** CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 902.447 | ** 902.447 | ||
+ | * common name: | ||
+ | ** geranylgeranyl bacteriochlorophyllide b | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[RXN-17481]] | * [[RXN-17481]] | ||
+ | * [[RXN-17483]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-17480]] | * [[RXN-17480]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706066 122706066] | ||
{{#set: smiles=CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | {{#set: smiles=CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | ||
− | |||
{{#set: molecular weight=902.447 }} | {{#set: molecular weight=902.447 }} | ||
− | {{#set: consumed by=RXN- | + | {{#set: common name=geranylgeranyl bacteriochlorophyllide b}} |
+ | {{#set: consumed by=RXN-17481|RXN-17483}} | ||
{{#set: produced by=RXN-17480}} | {{#set: produced by=RXN-17480}} |
Latest revision as of 14:41, 10 January 2019
Contents
Metabolite CPD-18890
- smiles:
- CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))
- molecular weight:
- 902.447
- common name:
- geranylgeranyl bacteriochlorophyllide b
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC=C5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))" cannot be used as a page name in this wiki.