Difference between revisions of "MENADIOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MENADIOL MENADIOL] == * smiles: ** CC1(=CC(O)=C2(C=CC=CC(=C(O)1)2)) * common name: ** menadiol...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(=CC(O)=C2(C=CC=CC(=C(O)1)2)) | ** CC1(=CC(O)=C2(C=CC=CC(=C(O)1)2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 174.199 | ** 174.199 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZJTLZYDQJHKRMQ-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** menadiol | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6746 6746] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6746 6746] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10209 10209] | ||
| + | * REFMET : Menadiol | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C07126 C07126] | ** [http://www.genome.jp/dbget-bin/www_bget?C07126 C07126] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.9794.html 9794] | ||
{{#set: smiles=CC1(=CC(O)=C2(C=CC=CC(=C(O)1)2))}} | {{#set: smiles=CC1(=CC(O)=C2(C=CC=CC(=C(O)1)2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=174.199 }} | {{#set: molecular weight=174.199 }} | ||
| + | {{#set: inchi key=InChIKey=ZJTLZYDQJHKRMQ-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=menadiol}} | ||
{{#set: produced by=NADH-DEHYDROGENASE-QUINONE-RXN}} | {{#set: produced by=NADH-DEHYDROGENASE-QUINONE-RXN}} | ||
Latest revision as of 10:49, 10 January 2019
Contents
Metabolite MENADIOL
- smiles:
- CC1(=CC(O)=C2(C=CC=CC(=C(O)1)2))
- molecular weight:
- 174.199
- inchi key:
- InChIKey=ZJTLZYDQJHKRMQ-UHFFFAOYSA-N
- common name:
- menadiol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
