Difference between revisions of "CPD-9925"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9925 CPD-9925] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-] | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 949.669 | ** 949.669 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J | ||
| + | * common name: | ||
| + | ** 1,4-dihydroxy-2-naphthoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** 1,4-dihydroxy-2-naphthoate-CoA | ** 1,4-dihydroxy-2-naphthoate-CoA | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58897 58897] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58897 58897] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878473 46878473] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C15547 C15547] | ** [http://www.genome.jp/dbget-bin/www_bget?C15547 C15547] | ||
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}} | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=949.669 }} | {{#set: molecular weight=949.669 }} | ||
| + | {{#set: inchi key=InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J}} | ||
| + | {{#set: common name=1,4-dihydroxy-2-naphthoyl-CoA}} | ||
{{#set: common name=1,4-dihydroxy-2-naphthoate-CoA|DHNA-CoA}} | {{#set: common name=1,4-dihydroxy-2-naphthoate-CoA|DHNA-CoA}} | ||
{{#set: produced by=NAPHTHOATE-SYN-RXN}} | {{#set: produced by=NAPHTHOATE-SYN-RXN}} | ||
Latest revision as of 13:44, 10 January 2019
Contents
Metabolite CPD-9925
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
- molecular weight:
- 949.669
- inchi key:
- InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J
- common name:
- 1,4-dihydroxy-2-naphthoyl-CoA
- Synonym(s):
- 1,4-dihydroxy-2-naphthoate-CoA
- DHNA-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-" cannot be used as a page name in this wiki.
