Difference between revisions of "CPD0-2231"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) | ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 409.165 | ** 409.165 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K | ||
| + | * common name: | ||
| + | ** dIDP | ||
* Synonym(s): | * Synonym(s): | ||
** deoxyinosine diphosphate | ** deoxyinosine diphosphate | ||
| Line 17: | Line 17: | ||
* [[RXN-14228]] | * [[RXN-14228]] | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552] |
| − | * | + | * REFMET : dIDP |
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286] | ||
| + | * HMDB : HMDB03536 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344] | ||
* BIGG : didp | * BIGG : didp | ||
| − | |||
| − | |||
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=409.165 }} | {{#set: molecular weight=409.165 }} | ||
| + | {{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}} | ||
| + | {{#set: common name=dIDP}} | ||
{{#set: common name=deoxyinosine diphosphate}} | {{#set: common name=deoxyinosine diphosphate}} | ||
{{#set: reversible reaction associated=RXN-14228}} | {{#set: reversible reaction associated=RXN-14228}} | ||
Latest revision as of 13:44, 10 January 2019
Contents
Metabolite CPD0-2231
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- molecular weight:
- 409.165
- inchi key:
- InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
- common name:
- dIDP
- Synonym(s):
- deoxyinosine diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
