Difference between revisions of "CPD-14378"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == * smiles: ** C([N+])CC[N+]=CCCC[N+] * common name: ** dehydrospermidine...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])CC[N+]=CCCC[N+] | ** C([N+])CC[N+]=CCCC[N+] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 146.255 | ** 146.255 | ||
+ | * inchi key: | ||
+ | ** InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q | ||
+ | * common name: | ||
+ | ** dehydrospermidine | ||
* Synonym(s): | * Synonym(s): | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * METABOLIGHTS : MTBLC58732 |
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732] | ||
− | * | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266746 45266746] | ||
{{#set: smiles=C([N+])CC[N+]=CCCC[N+]}} | {{#set: smiles=C([N+])CC[N+]=CCCC[N+]}} | ||
− | |||
− | |||
{{#set: molecular weight=146.255 }} | {{#set: molecular weight=146.255 }} | ||
+ | {{#set: inchi key=InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q}} | ||
+ | {{#set: common name=dehydrospermidine}} | ||
{{#set: consumed by=RXN-13415}} | {{#set: consumed by=RXN-13415}} | ||
{{#set: produced by=RXN-13414}} | {{#set: produced by=RXN-13414}} |
Latest revision as of 14:48, 10 January 2019
Contents
Metabolite CPD-14378
- smiles:
- C([N+])CC[N+]=CCCC[N+]
- molecular weight:
- 146.255
- inchi key:
- InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
- common name:
- dehydrospermidine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])CC[N+]=CCCC[N+" cannot be used as a page name in this wiki.