Difference between revisions of "THZ-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * common name: ** 4-methyl-5-(2-p...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) | ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 221.167 | ** 221.167 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** 4-methyl-5-(2-phosphooxyethyl)thiazole | ||
* Synonym(s): | * Synonym(s): | ||
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole | ** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole | ||
| Line 22: | Line 22: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327] | ** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327] | ||
| + | * BIGG : 4mpetz | ||
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}} | {{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=221.167 }} | {{#set: molecular weight=221.167 }} | ||
| + | {{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}} | ||
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}} | {{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}} | ||
{{#set: consumed by=THI-P-SYN-RXN}} | {{#set: consumed by=THI-P-SYN-RXN}} | ||
{{#set: produced by=THIAZOLSYN3-RXN}} | {{#set: produced by=THIAZOLSYN3-RXN}} | ||
Latest revision as of 13:49, 10 January 2019
Contents
Metabolite THZ-P
- smiles:
- CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
- molecular weight:
- 221.167
- inchi key:
- InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
- common name:
- 4-methyl-5-(2-phosphooxyethyl)thiazole
- Synonym(s):
- 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
- 4-methyl-5-(2-phosphoethyl)-thiazole
- THZ-P
- 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
- HET-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(N=CSC(CCOP([O-])(=O)[O-])=1)" cannot be used as a page name in this wiki.
