Difference between revisions of "EDTA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * common na...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O | ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 290.229 | ** 290.229 | ||
| + | * inchi key: | ||
| + | ** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** EDTA | ||
* Synonym(s): | * Synonym(s): | ||
** ethylenediaminetetraacetic acid | ** ethylenediaminetetraacetic acid | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TransportSeed-EDTA]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TransportSeed-EDTA]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[ExchangeSeed-EDTA]] |
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64755 64755] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5246202 5246202] |
* HMDB : HMDB15109 | * HMDB : HMDB15109 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284] | ** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284] | ||
| + | * GO-TERMS : (REFMET "Edetic Acid" NIL midford 3701443689 NIL NIL) | ||
{{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}} | {{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=290.229 }} | {{#set: molecular weight=290.229 }} | ||
| + | {{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=EDTA}} | ||
{{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}} | {{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=TransportSeed-EDTA}} |
| − | {{#set: produced by= | + | {{#set: produced by=TransportSeed-EDTA}} |
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=ExchangeSeed-EDTA}} |
Latest revision as of 13:51, 10 January 2019
Contents
Metabolite EDTA
- smiles:
- C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
- molecular weight:
- 290.229
- inchi key:
- InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
- common name:
- EDTA
- Synonym(s):
- ethylenediaminetetraacetic acid
- ethylenediaminetetraacetate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
- PUBCHEM:
- HMDB : HMDB15109
- LIGAND-CPD:
- GO-TERMS : (REFMET "Edetic Acid" NIL midford 3701443689 NIL NIL)
"C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.
