Difference between revisions of "CPD-15435"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O | ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 490.322 | ** 490.322 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L | ||
| + | * common name: | ||
| + | ** L-threonylcarbamoyladenylate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 17: | Line 17: | ||
* [[RXN-14569]] | * [[RXN-14569]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565] | ||
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}} | {{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=490.322 }} | {{#set: molecular weight=490.322 }} | ||
| + | {{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}} | ||
| + | {{#set: common name=L-threonylcarbamoyladenylate}} | ||
{{#set: consumed by=RXN-14570}} | {{#set: consumed by=RXN-14570}} | ||
{{#set: reversible reaction associated=RXN-14569}} | {{#set: reversible reaction associated=RXN-14569}} | ||
Latest revision as of 14:05, 10 January 2019
Contents
Metabolite CPD-15435
- smiles:
- CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
- molecular weight:
- 490.322
- inchi key:
- InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
- common name:
- L-threonylcarbamoyladenylate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O" cannot be used as a page name in this wiki.
