Difference between revisions of "CPD-8978"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8978 CPD-8978] == * smiles: ** CCOP([O-])(=O)[O-] * common name: ** ethylphosphate * inchi...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCOP([O-])(=O)[O-] | ** CCOP([O-])(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 124.033 | ** 124.033 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZJXZSIYSNXKHEA-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** ethylphosphate | ||
* Synonym(s): | * Synonym(s): | ||
Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC59760 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12691392 12691392] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12691392 12691392] | ||
− | * | + | * HMDB : HMDB12228 |
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59760 59760] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59760 59760] | ||
− | * | + | * CHEMSPIDER: |
− | * | + | ** [http://www.chemspider.com/Chemical-Structure.10632660.html 10632660] |
{{#set: smiles=CCOP([O-])(=O)[O-]}} | {{#set: smiles=CCOP([O-])(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=124.033 }} | {{#set: molecular weight=124.033 }} | ||
+ | {{#set: inchi key=InChIKey=ZJXZSIYSNXKHEA-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=ethylphosphate}} | ||
{{#set: consumed by=RXN-8748}} | {{#set: consumed by=RXN-8748}} |
Latest revision as of 15:09, 10 January 2019
Contents
Metabolite CPD-8978
- smiles:
- CCOP([O-])(=O)[O-]
- molecular weight:
- 124.033
- inchi key:
- InChIKey=ZJXZSIYSNXKHEA-UHFFFAOYSA-L
- common name:
- ethylphosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCOP([O-])(=O)[O-" cannot be used as a page name in this wiki.