Difference between revisions of "CPD-13927"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13927 CPD-13927] == * smiles: ** CC(=CNC(N)=O)C(=O)OO * common name: ** (Z)-2-methylureidoa...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CNC(N)=O)C(=O)OO | ** CC(=CNC(N)=O)C(=O)OO | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 160.129 | ** 160.129 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GHIKATUDZMBUJC-IHWYPQMZSA-N | ||
| + | * common name: | ||
| + | ** (Z)-2-methylureidoacrylate peracid | ||
* Synonym(s): | * Synonym(s): | ||
** (Z)-2-methylureidoperacrylic acid | ** (Z)-2-methylureidoperacrylic acid | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63249 63249] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63249 63249] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927741 56927741] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927741 56927741] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C20232 C20232] | ||
{{#set: smiles=CC(=CNC(N)=O)C(=O)OO}} | {{#set: smiles=CC(=CNC(N)=O)C(=O)OO}} | ||
| − | |||
| − | |||
{{#set: molecular weight=160.129 }} | {{#set: molecular weight=160.129 }} | ||
| + | {{#set: inchi key=InChIKey=GHIKATUDZMBUJC-IHWYPQMZSA-N}} | ||
| + | {{#set: common name=(Z)-2-methylureidoacrylate peracid}} | ||
{{#set: common name=(Z)-2-methylureidoperacrylic acid|(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid}} | {{#set: common name=(Z)-2-methylureidoperacrylic acid|(2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid}} | ||
{{#set: consumed by=RXN-12896|RXN-12895}} | {{#set: consumed by=RXN-12896|RXN-12895}} | ||
Latest revision as of 14:12, 10 January 2019
Contents
Metabolite CPD-13927
- smiles:
- CC(=CNC(N)=O)C(=O)OO
- molecular weight:
- 160.129
- inchi key:
- InChIKey=GHIKATUDZMBUJC-IHWYPQMZSA-N
- common name:
- (Z)-2-methylureidoacrylate peracid
- Synonym(s):
- (Z)-2-methylureidoperacrylic acid
- (2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
