Difference between revisions of "ISOPHENOXAZINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPHENOXAZINE ISOPHENOXAZINE] == * smiles: ** C1(C=CC2(=C(C=1)N=C3(C=C(C(=O)C=C(O2)3)N))) * co...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C=CC2(=C(C=1)N=C3(C=C(C(=O)C=C(O2)3)N))) | ** C1(C=CC2(=C(C=1)N=C3(C=C(C(=O)C=C(O2)3)N))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 212.207 | ** 212.207 | ||
| + | * inchi key: | ||
| + | ** InChIKey=RDJXPXHQENRCNG-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** isophenoxazine | ||
* Synonym(s): | * Synonym(s): | ||
** 2-amino-3H-phenoxazin-3-one | ** 2-amino-3H-phenoxazin-3-one | ||
| Line 20: | Line 20: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[O-AMINOPHENOL-OXIDASE-RXN]] | * [[O-AMINOPHENOL-OXIDASE-RXN]] | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17293 17293] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72725 72725] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72725 72725] | ||
| − | |||
| − | |||
* HMDB : HMDB30483 | * HMDB : HMDB30483 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02161 C02161] | ** [http://www.genome.jp/dbget-bin/www_bget?C02161 C02161] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.65565.html 65565] | ||
{{#set: smiles=C1(C=CC2(=C(C=1)N=C3(C=C(C(=O)C=C(O2)3)N)))}} | {{#set: smiles=C1(C=CC2(=C(C=1)N=C3(C=C(C(=O)C=C(O2)3)N)))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=212.207 }} | {{#set: molecular weight=212.207 }} | ||
| + | {{#set: inchi key=InChIKey=RDJXPXHQENRCNG-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=isophenoxazine}} | ||
{{#set: common name=2-amino-3H-phenoxazin-3-one|2-amino-phenoxazin-3-one|questiomycin A|2-aminophenoxazon|2-aminophenoxazone|2-amino-3-phenoxazone}} | {{#set: common name=2-amino-3H-phenoxazin-3-one|2-amino-phenoxazin-3-one|questiomycin A|2-aminophenoxazon|2-aminophenoxazone|2-amino-3-phenoxazone}} | ||
| − | {{#set: produced by=O-AMINOPHENOL-OXIDASE-RXN | + | {{#set: produced by=O-AMINOPHENOL-OXIDASE-RXN}} |
Latest revision as of 14:16, 10 January 2019
Contents
Metabolite ISOPHENOXAZINE
- smiles:
- C1(C=CC2(=C(C=1)N=C3(C=C(C(=O)C=C(O2)3)N)))
- molecular weight:
- 212.207
- inchi key:
- InChIKey=RDJXPXHQENRCNG-UHFFFAOYSA-N
- common name:
- isophenoxazine
- Synonym(s):
- 2-amino-3H-phenoxazin-3-one
- 2-amino-phenoxazin-3-one
- questiomycin A
- 2-aminophenoxazon
- 2-aminophenoxazone
- 2-amino-3-phenoxazone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
