Difference between revisions of "CPD-10488"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * common name:...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) | ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 236.227 | ** 236.227 | ||
+ | * inchi key: | ||
+ | ** InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** N-formyl-D-kynurenine | ||
* Synonym(s): | * Synonym(s): | ||
Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55476 55476] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245041 25245041] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245041 25245041] | ||
* HMDB : HMDB01200 | * HMDB : HMDB01200 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C15605 C15605] | ** [http://www.genome.jp/dbget-bin/www_bget?C15605 C15605] | ||
{{#set: smiles=C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)}} | {{#set: smiles=C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)}} | ||
− | |||
− | |||
{{#set: molecular weight=236.227 }} | {{#set: molecular weight=236.227 }} | ||
+ | {{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=N-formyl-D-kynurenine}} | ||
{{#set: produced by=RXN-8664}} | {{#set: produced by=RXN-8664}} |
Latest revision as of 14:21, 10 January 2019
Contents
Metabolite CPD-10488
- smiles:
- C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)
- molecular weight:
- 236.227
- inchi key:
- InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N
- common name:
- N-formyl-D-kynurenine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)" cannot be used as a page name in this wiki.