Difference between revisions of "INDOLE-3-GLYCEROL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O) | ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 285.193 | ** 285.193 | ||
| + | * inchi key: | ||
| + | ** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L | ||
| + | * common name: | ||
| + | ** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** C1-(3-Indolyl)-glycerol 3-phosphate | ** C1-(3-Indolyl)-glycerol 3-phosphate | ||
| Line 24: | Line 24: | ||
* [[RXN0-2381]] | * [[RXN0-2381]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506] | ** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506] | ||
| + | * BIGG : 3ig3p | ||
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}} | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=285.193 }} | {{#set: molecular weight=285.193 }} | ||
| + | {{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}} | ||
| + | {{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}} | ||
{{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}} | {{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}} | ||
{{#set: consumed by=TRYPSYN-RXN}} | {{#set: consumed by=TRYPSYN-RXN}} | ||
{{#set: produced by=IGPSYN-RXN}} | {{#set: produced by=IGPSYN-RXN}} | ||
{{#set: reversible reaction associated=RXN0-2381}} | {{#set: reversible reaction associated=RXN0-2381}} | ||
Latest revision as of 10:54, 10 January 2019
Contents
Metabolite INDOLE-3-GLYCEROL-P
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
- molecular weight:
- 285.193
- inchi key:
- InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
- common name:
- (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
- Synonym(s):
- C1-(3-Indolyl)-glycerol 3-phosphate
- indole-3-glycerol-P
- 1-(indol-3-yl)glycerol-3-P
- 1-(indol-3-yl)glycerol-3-phosphate
- indoleglycerol phosphate
- indole-3-glycerol-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)" cannot be used as a page name in this wiki.
