Difference between revisions of "CPD-11715"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * common name: ** phenyla...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) | ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 192.194 | ** 192.194 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** phenylacetylglycine | ||
* Synonym(s): | * Synonym(s): | ||
** phenaceturic acid | ** phenaceturic acid | ||
| Line 22: | Line 22: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702] | ||
| + | * REFMET : Phenylacetylglycine | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658] | ** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658] | ||
| − | |||
| − | |||
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}} | {{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=192.194 }} | {{#set: molecular weight=192.194 }} | ||
| + | {{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=phenylacetylglycine}} | ||
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}} | {{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}} | ||
{{#set: produced by=RXN-10821}} | {{#set: produced by=RXN-10821}} | ||
Latest revision as of 14:26, 10 January 2019
Contents
Metabolite CPD-11715
- smiles:
- C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
- molecular weight:
- 192.194
- inchi key:
- InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
- common name:
- phenylacetylglycine
- Synonym(s):
- phenaceturic acid
- phenacetylglycine
- N-phenacetylglycine
- N-phenylacetylglycine
- N-(phenylacetyl)glycine
- glycine, N-(phenylacetyl)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)" cannot be used as a page name in this wiki.
