Difference between revisions of "CPD-3569"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3569 CPD-3569] == * smiles: ** C([N+])C(=O)NC(CCC(=O)[O-])C([O-])=O * common name: ** glycy...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C(=O)NC(CCC(=O)[O-])C([O-])=O | ** C([N+])C(=O)NC(CCC(=O)[O-])C([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 203.174 | ** 203.174 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IEFJWDNGDZAYNZ-BYPYZUCNSA-M | ||
+ | * common name: | ||
+ | ** glycyl-L-glutamate | ||
* Synonym(s): | * Synonym(s): | ||
** glycyl-L-glutamic acid | ** glycyl-L-glutamic acid | ||
− | ** | + | ** Gly-Glu |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73784 73784] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73784 73784] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7020885 7020885] | ||
* HMDB : HMDB28840 | * HMDB : HMDB28840 | ||
+ | * CAS : 7412-78-4 | ||
{{#set: smiles=C([N+])C(=O)NC(CCC(=O)[O-])C([O-])=O}} | {{#set: smiles=C([N+])C(=O)NC(CCC(=O)[O-])C([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=203.174 }} | {{#set: molecular weight=203.174 }} | ||
− | {{#set: common name=glycyl-L-glutamic acid| | + | {{#set: inchi key=InChIKey=IEFJWDNGDZAYNZ-BYPYZUCNSA-M}} |
+ | {{#set: common name=glycyl-L-glutamate}} | ||
+ | {{#set: common name=glycyl-L-glutamic acid|Gly-Glu}} | ||
{{#set: consumed by=RXN0-6984}} | {{#set: consumed by=RXN0-6984}} |
Latest revision as of 15:31, 10 January 2019
Contents
Metabolite CPD-3569
- smiles:
- C([N+])C(=O)NC(CCC(=O)[O-])C([O-])=O
- molecular weight:
- 203.174
- inchi key:
- InChIKey=IEFJWDNGDZAYNZ-BYPYZUCNSA-M
- common name:
- glycyl-L-glutamate
- Synonym(s):
- glycyl-L-glutamic acid
- Gly-Glu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C(=O)NC(CCC(=O)[O-])C([O-])=O" cannot be used as a page name in this wiki.