Difference between revisions of "CPD-15616"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * common name: ** keto-L-sorbose *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(=O)C(O)C(O)C(O)CO | ** C(O)C(=O)C(O)C(O)C(O)CO | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 180.157 | ** 180.157 | ||
+ | * inchi key: | ||
+ | ** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N | ||
+ | * common name: | ||
+ | ** keto-L-sorbose | ||
* Synonym(s): | * Synonym(s): | ||
Line 14: | Line 14: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[L-IDITOL-2-DEHYDROGENASE-RXN]] | * [[L-IDITOL-2-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC13172 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172] | ||
− | * | + | * REFMET : Sorbose |
{{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | ||
− | |||
− | |||
{{#set: molecular weight=180.157 }} | {{#set: molecular weight=180.157 }} | ||
− | {{#set: reversible reaction associated= | + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}} |
+ | {{#set: common name=keto-L-sorbose}} | ||
+ | {{#set: reversible reaction associated=L-IDITOL-2-DEHYDROGENASE-RXN}} |
Latest revision as of 15:32, 10 January 2019
Contents
Metabolite CPD-15616
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- molecular weight:
- 180.157
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
- common name:
- keto-L-sorbose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links