Difference between revisions of "CPD-15424"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15424 CPD-15424] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)N)(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)N)([O-])=O | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)N)([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 389.241 | ** 389.241 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CHSNPOFVFYPELH-KQYNXXCUSA-M | ||
| + | * common name: | ||
| + | ** O-carbamoyladenylate | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-13168]] | * [[RXN-13168]] | ||
* [[RXN-14553]] | * [[RXN-14553]] | ||
| + | * [[RXN-13167]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-14552]] | * [[RXN-14552]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73674 73674] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73674 73674] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464515 71464515] | ||
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)N)([O-])=O}} | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)N)([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=389.241 }} | {{#set: molecular weight=389.241 }} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=CHSNPOFVFYPELH-KQYNXXCUSA-M}} |
| + | {{#set: common name=O-carbamoyladenylate}} | ||
| + | {{#set: consumed by=RXN-13168|RXN-14553|RXN-13167}} | ||
{{#set: produced by=RXN-14552}} | {{#set: produced by=RXN-14552}} | ||
Latest revision as of 14:33, 10 January 2019
Contents
Metabolite CPD-15424
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)N)([O-])=O
- molecular weight:
- 389.241
- inchi key:
- InChIKey=CHSNPOFVFYPELH-KQYNXXCUSA-M
- common name:
- O-carbamoyladenylate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)N)([O-])=O" cannot be used as a page name in this wiki.
