Difference between revisions of "CPD-19487"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-is...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] | ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 274.331 | ** 274.331 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** 3-isopropyl-10-(methylthio)-2-oxodecanoate | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[RXN-18200]] | * [[RXN-18200]] | ||
== External links == | == External links == | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=123131585 123131585] | ||
{{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} | {{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=274.331 }} | {{#set: molecular weight=274.331 }} | ||
| − | {{#set: | + | {{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}} |
| + | {{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}} | ||
{{#set: reversible reaction associated=RXN-18200}} | {{#set: reversible reaction associated=RXN-18200}} | ||
Latest revision as of 14:38, 10 January 2019
Contents
Metabolite CPD-19487
- smiles:
- CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- molecular weight:
- 274.331
- inchi key:
- InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
- common name:
- 3-isopropyl-10-(methylthio)-2-oxodecanoate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
