Difference between revisions of "CPD-3762"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] == * smiles: ** C1(=NC(C(N)=O)C(N)=N1) * common name: ** 5-amino-4-imidazole...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=NC(C(N)=O)C(N)=N1) | ** C1(=NC(C(N)=O)C(N)=N1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 126.118 | ** 126.118 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 5-amino-4-imidazolecarboxyamide | ||
* Synonym(s): | * Synonym(s): | ||
** 1H-imidazole-4-carboxamide, 5-amino- | ** 1H-imidazole-4-carboxamide, 5-amino- | ||
| Line 17: | Line 17: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14270]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2030 2030] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2030 2030] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202832 25202832] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202832 25202832] | ||
| + | * HMDB : HMDB03192 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04051 C04051] | ||
{{#set: smiles=C1(=NC(C(N)=O)C(N)=N1)}} | {{#set: smiles=C1(=NC(C(N)=O)C(N)=N1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=126.118 }} | {{#set: molecular weight=126.118 }} | ||
| + | {{#set: inchi key=InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=5-amino-4-imidazolecarboxyamide}} | ||
{{#set: common name=1H-imidazole-4-carboxamide, 5-amino-|5(4)-amino-4(5)-imidazolecarboxamide|5-aminoimidazole-4-carboxamide|4-amino-5-carbamoylimidazole|4-amino-5-imidazolecarboxamide}} | {{#set: common name=1H-imidazole-4-carboxamide, 5-amino-|5(4)-amino-4(5)-imidazolecarboxamide|5-aminoimidazole-4-carboxamide|4-amino-5-carbamoylimidazole|4-amino-5-imidazolecarboxamide}} | ||
| − | {{#set: | + | {{#set: consumed by=RXN-14270}} |
Latest revision as of 14:44, 10 January 2019
Contents
Metabolite CPD-3762
- smiles:
- C1(=NC(C(N)=O)C(N)=N1)
- molecular weight:
- 126.118
- inchi key:
- InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N
- common name:
- 5-amino-4-imidazolecarboxyamide
- Synonym(s):
- 1H-imidazole-4-carboxamide, 5-amino-
- 5(4)-amino-4(5)-imidazolecarboxamide
- 5-aminoimidazole-4-carboxamide
- 4-amino-5-carbamoylimidazole
- 4-amino-5-imidazolecarboxamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
