Difference between revisions of "CPD-7733"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7733 CPD-7733] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCC2(C(C1(C=CC=CC=1N(C(C)=2)O))=O) * c...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCC2(C(C1(C=CC=CC=1N(C(C)=2)O))=O) | ** CC(C)=CCCC(C)=CCCC(C)=CCC2(C(C1(C=CC=CC=1N(C(C)=2)O))=O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 379.541 | ** 379.541 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FIHXCHBEHLCXEG-YEFHWUCQSA-N | ||
| + | * common name: | ||
| + | ** aurachin C | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-17335]] | * [[RXN-17335]] | ||
| + | * [[RXN-15029]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.4943600.html 4943600] | ** [http://www.chemspider.com/Chemical-Structure.4943600.html 4943600] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90888 90888] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90888 90888] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C21330 C21330] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6439171 6439171] | ||
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC2(C(C1(C=CC=CC=1N(C(C)=2)O))=O)}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC2(C(C1(C=CC=CC=1N(C(C)=2)O))=O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=379.541 }} | {{#set: molecular weight=379.541 }} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=FIHXCHBEHLCXEG-YEFHWUCQSA-N}} |
| + | {{#set: common name=aurachin C}} | ||
| + | {{#set: consumed by=RXN-17335|RXN-15029}} | ||
Latest revision as of 14:49, 10 January 2019
Contents
Metabolite CPD-7733
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCC2(C(C1(C=CC=CC=1N(C(C)=2)O))=O)
- molecular weight:
- 379.541
- inchi key:
- InChIKey=FIHXCHBEHLCXEG-YEFHWUCQSA-N
- common name:
- aurachin C
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
