Difference between revisions of "CPD-1113"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1113 CPD-1113] == * smiles: ** C(O)C2(C(C(O)C([N+])C(OC1(C(C(O)C(O)C(O)C1O)OP(=O)([O-])OCC(...") |
|||
Line 10: | Line 10: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[3.1.1.69-RXN]] | * [[3.1.1.69-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57997 57997] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57997 57997] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791968 49791968] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04248 C04248] | ** [http://www.genome.jp/dbget-bin/www_bget?C04248 C04248] | ||
Line 22: | Line 22: | ||
{{#set: common name=6-(α-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol}} | {{#set: common name=6-(α-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol}} | ||
{{#set: common name=D-glucosaminylphosphatidylinositol}} | {{#set: common name=D-glucosaminylphosphatidylinositol}} | ||
− | {{#set: | + | {{#set: produced by=3.1.1.69-RXN}} |
Latest revision as of 15:54, 10 January 2019
Contents
Metabolite CPD-1113
- smiles:
- C(O)C2(C(C(O)C([N+])C(OC1(C(C(O)C(O)C(O)C1O)OP(=O)([O-])OCC(OC(=O)[R2])COC([R1])=O))O2)O)
- common name:
- 6-(α-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol
- Synonym(s):
- D-glucosaminylphosphatidylinositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C2(C(C(O)C([N+])C(OC1(C(C(O)C(O)C(O)C1O)OP(=O)([O-])OCC(OC(=O)[R2])COC([R1])=O))O2)O)" cannot be used as a page name in this wiki.