Difference between revisions of "CPD-11673"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) | ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 353.328 | ** 353.328 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 5-hydroxytryptophol glucuronide | ||
* Synonym(s): | * Synonym(s): | ||
Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086] | ||
{{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}} | {{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}} | ||
− | |||
− | |||
{{#set: molecular weight=353.328 }} | {{#set: molecular weight=353.328 }} | ||
+ | {{#set: inchi key=InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=5-hydroxytryptophol glucuronide}} | ||
{{#set: produced by=RXN-10784}} | {{#set: produced by=RXN-10784}} |
Latest revision as of 15:54, 10 January 2019
Contents
Metabolite CPD-11673
- smiles:
- C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
- molecular weight:
- 353.328
- inchi key:
- InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
- common name:
- 5-hydroxytryptophol glucuronide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: