Difference between revisions of "GLC-6-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * common name: ** &bet...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O | ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 258.121 | ** 258.121 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L | ||
+ | * common name: | ||
+ | ** β-D-glucose 6-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** β-D-glucose-6-P | ** β-D-glucose-6-P | ||
Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[G6PBDHh]] | * [[G6PBDHh]] | ||
− | |||
* [[RXN66-579]] | * [[RXN66-579]] | ||
+ | * [[G6PBDH]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
* [[PGIBh]] | * [[PGIBh]] | ||
+ | * [[G6PI]] | ||
+ | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | ||
+ | * [[PGIB]] | ||
== External links == | == External links == | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247] | ||
* HMDB : HMDB03498 | * HMDB : HMDB03498 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172] | ** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172] | ||
− | |||
− | |||
− | |||
− | |||
* BIGG : g6p | * BIGG : g6p | ||
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}} | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=258.121 }} | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}} | ||
+ | {{#set: common name=β-D-glucose 6-phosphate}} | ||
{{#set: common name=β-D-glucose-6-P}} | {{#set: common name=β-D-glucose-6-P}} | ||
− | {{#set: consumed by=G6PBDHh | + | {{#set: consumed by=G6PBDHh|RXN66-579|G6PBDH}} |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=PGIBh|G6PI|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGIB}} |
Latest revision as of 11:57, 10 January 2019
Contents
Metabolite GLC-6-P
- smiles:
- C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
- molecular weight:
- 258.121
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
- common name:
- β-D-glucose 6-phosphate
- Synonym(s):
- β-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.