Difference between revisions of "DCTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 463.127 | ** 463.127 | ||
| + | * inchi key: | ||
| + | ** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J | ||
| + | * common name: | ||
| + | ** dCTP | ||
* Synonym(s): | * Synonym(s): | ||
** 2'-deoxycytidine-5'-triphosphate | ** 2'-deoxycytidine-5'-triphosphate | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DCTUP]] | ||
| + | * [[DCTCP]] | ||
* [[RXN-14216]] | * [[RXN-14216]] | ||
* [[DCTP-PYROPHOSPHATASE-RXN]] | * [[DCTP-PYROPHOSPHATASE-RXN]] | ||
* [[RXN-14198]] | * [[RXN-14198]] | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[ATDCD]] | * [[ATDCD]] | ||
| − | * [[ | + | * [[RXN0-723]] |
* [[ATDCDm]] | * [[ATDCDm]] | ||
| + | * [[DCDPKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[DCTPtm]] | * [[DCTPtm]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] | ||
| − | * | + | * REFMET : dCTP |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] | ||
| + | * CAS : 2056-98-6 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458] | ||
| + | * HMDB : HMDB00998 | ||
* BIGG : dctp | * BIGG : dctp | ||
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=463.127 }} | {{#set: molecular weight=463.127 }} | ||
| + | {{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} | ||
| + | {{#set: common name=dCTP}} | ||
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} | {{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} | ||
| − | {{#set: consumed by=RXN-14216|DCTP-PYROPHOSPHATASE-RXN|RXN-14198 | + | {{#set: consumed by=DCTUP|DCTCP|RXN-14216|DCTP-PYROPHOSPHATASE-RXN|RXN-14198}} |
| − | {{#set: produced by=RXN0-723| | + | {{#set: produced by=ATDCD|RXN0-723|ATDCDm|DCDPKIN-RXN}} |
{{#set: reversible reaction associated=DCTPtm}} | {{#set: reversible reaction associated=DCTPtm}} | ||
Latest revision as of 14:57, 10 January 2019
Contents
Metabolite DCTP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- molecular weight:
- 463.127
- inchi key:
- InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
- common name:
- dCTP
- Synonym(s):
- 2'-deoxycytidine-5'-triphosphate
- deoxycytidine-triphosphate
- deoxy-CTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- REFMET : dCTP
- CHEBI:
- CAS : 2056-98-6
- LIGAND-CPD:
- HMDB : HMDB00998
- BIGG : dctp
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
