Difference between revisions of "ACETYL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-P ACETYL-P] == * smiles: ** CC(OP([O-])(=O)[O-])=O * common name: ** acetyl phosphate *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(OP([O-])(=O)[O-])=O | ** CC(OP([O-])(=O)[O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 138.016 | ** 138.016 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** acetyl phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** acetyl-P | ** acetyl-P | ||
Line 15: | Line 15: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[PHOSACETYLTRANS-RXN]] | ||
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]] | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.3394205.html 3394205] | ** [http://www.chemspider.com/Chemical-Structure.3394205.html 3394205] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4183249 4183249] | ||
+ | * REFMET : Acetylphosphate | ||
+ | * UM-BBD-CPD : c0049 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=22191 22191] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=22191 22191] | ||
+ | * CAS : 19926-71-7 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00227 C00227] | ||
+ | * HMDB : HMDB01494 | ||
* BIGG : actp | * BIGG : actp | ||
{{#set: smiles=CC(OP([O-])(=O)[O-])=O}} | {{#set: smiles=CC(OP([O-])(=O)[O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=138.016 }} | {{#set: molecular weight=138.016 }} | ||
+ | {{#set: inchi key=InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=acetyl phosphate}} | ||
{{#set: common name=acetyl-P}} | {{#set: common name=acetyl-P}} | ||
− | {{#set: reversible reaction associated=LYSINE-N-ACETYLTRANSFERASE | + | {{#set: reversible reaction associated=PHOSACETYLTRANS-RXN|LYSINE-N-ACETYLTRANSFERASE-RXN}} |
Latest revision as of 14:57, 10 January 2019
Contents
Metabolite ACETYL-P
- smiles:
- CC(OP([O-])(=O)[O-])=O
- molecular weight:
- 138.016
- inchi key:
- InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L
- common name:
- acetyl phosphate
- Synonym(s):
- acetyl-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEMSPIDER:
- PUBCHEM:
- REFMET : Acetylphosphate
- UM-BBD-CPD : c0049
- CHEBI:
- CAS : 19926-71-7
- LIGAND-CPD:
- HMDB : HMDB01494
- BIGG : actp
"CC(OP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.