Difference between revisions of "CPD-7109"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * common name:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C | ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 277.339 | ** 277.339 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** 4-prenylphlorisovalerophenone | ||
* Synonym(s): | * Synonym(s): | ||
** PPIVP | ** PPIVP | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 22: | Line 21: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610] | ||
{{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}} | {{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=277.339 }} | {{#set: molecular weight=277.339 }} | ||
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}} |
| + | {{#set: common name=4-prenylphlorisovalerophenone}} | ||
| + | {{#set: common name=PPIVP}} | ||
{{#set: consumed by=RXN-7810}} | {{#set: consumed by=RXN-7810}} | ||
{{#set: produced by=RXN-7811}} | {{#set: produced by=RXN-7811}} | ||
Latest revision as of 10:57, 10 January 2019
Contents
Metabolite CPD-7109
- smiles:
- CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
- molecular weight:
- 277.339
- inchi key:
- InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
- common name:
- 4-prenylphlorisovalerophenone
- Synonym(s):
- PPIVP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.
