Difference between revisions of "CPD-14392"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 1021.905 | ** 1021.905 | ||
| + | * inchi key: | ||
| + | ** InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J | ||
| + | * common name: | ||
| + | ** stearidonoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA | ** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[RXN-13426]] | * [[RXN-13426]] | ||
| + | * [[RXN-16041]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71489 71489] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71489 71489] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698349 70698349] | ||
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=1021.905 }} | {{#set: molecular weight=1021.905 }} | ||
| + | {{#set: inchi key=InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J}} | ||
| + | {{#set: common name=stearidonoyl-CoA}} | ||
{{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA}} | {{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA}} | ||
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-13426|RXN-16041}} |
Latest revision as of 14:59, 10 January 2019
Contents
Metabolite CPD-14392
- smiles:
- CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1021.905
- inchi key:
- InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J
- common name:
- stearidonoyl-CoA
- Synonym(s):
- (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
