Difference between revisions of "CPD-15837"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15837 CPD-15837] == * smiles: ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=CC=2C)O)C)))C)C)C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=CC=2C)O)C)))C)C)C | ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=CC=2C)O)C)))C)C)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 410.639 | ** 410.639 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FGYKUFVNYVMTAM-WAZJVIJMSA-N | ||
| + | * common name: | ||
| + | ** β-tocotrienol | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33275 33275] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33275 33275] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282348 5282348] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282348 5282348] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C14154 C14154] | ||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=CC=2C)O)C)))C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=CC=2C)O)C)))C)C)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=410.639 }} | {{#set: molecular weight=410.639 }} | ||
| + | {{#set: inchi key=InChIKey=FGYKUFVNYVMTAM-WAZJVIJMSA-N}} | ||
| + | {{#set: common name=β-tocotrienol}} | ||
{{#set: produced by=RXN-14919}} | {{#set: produced by=RXN-14919}} | ||
Latest revision as of 15:59, 10 January 2019
Contents
Metabolite CPD-15837
- smiles:
- CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=CC=2C)O)C)))C)C)C
- molecular weight:
- 410.639
- inchi key:
- InChIKey=FGYKUFVNYVMTAM-WAZJVIJMSA-N
- common name:
- β-tocotrienol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
