Difference between revisions of "CPD-6994"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * co...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 287.248 | ** 287.248 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M | ||
| + | * common name: | ||
| + | ** (2S)-eriodictyol | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147] | ||
* HMDB : HMDB05810 | * HMDB : HMDB05810 | ||
| − | * | + | * REFMET : Eriodictyol |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631] | ** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631] | ||
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}} | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=287.248 }} | {{#set: molecular weight=287.248 }} | ||
| + | {{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}} | ||
| + | {{#set: common name=(2S)-eriodictyol}} | ||
{{#set: consumed by=RXN-7775}} | {{#set: consumed by=RXN-7775}} | ||
Latest revision as of 15:03, 10 January 2019
Contents
Metabolite CPD-6994
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
- molecular weight:
- 287.248
- inchi key:
- InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
- common name:
- (2S)-eriodictyol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)" cannot be used as a page name in this wiki.
