Difference between revisions of "CPD-13473"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13473 CPD-13473] == * smiles: ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) | ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 378.312 | ** 378.312 | ||
+ | * inchi key: | ||
+ | ** InChIKey=DLGJWSVWTWEWBJ-ZDLRKIOHSA-M | ||
+ | * common name: | ||
+ | ** 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-glucosamine | ||
* Synonym(s): | * Synonym(s): | ||
** β-D-4-deoxy-Δ4-GlcAp-(1→3)-β-D-GlcNAc | ** β-D-4-deoxy-Δ4-GlcAp-(1→3)-β-D-GlcNAc | ||
Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=132151 132151] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820239 91820239] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820239 91820239] | ||
* HMDB : HMDB60071 | * HMDB : HMDB60071 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04794 C04794] | ** [http://www.genome.jp/dbget-bin/www_bget?C04794 C04794] | ||
{{#set: smiles=CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}} | {{#set: smiles=CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}} | ||
− | |||
− | |||
{{#set: molecular weight=378.312 }} | {{#set: molecular weight=378.312 }} | ||
+ | {{#set: inchi key=InChIKey=DLGJWSVWTWEWBJ-ZDLRKIOHSA-M}} | ||
+ | {{#set: common name=3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-glucosamine}} | ||
{{#set: common name=β-D-4-deoxy-Δ4-GlcAp-(1→3)-β-D-GlcNAc|3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-glucose|4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-glucosamine}} | {{#set: common name=β-D-4-deoxy-Δ4-GlcAp-(1→3)-β-D-GlcNAc|3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-glucose|4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-glucosamine}} | ||
{{#set: consumed by=RXN-16485}} | {{#set: consumed by=RXN-16485}} |
Latest revision as of 16:09, 10 January 2019
Contents
Metabolite CPD-13473
- smiles:
- CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
- molecular weight:
- 378.312
- inchi key:
- InChIKey=DLGJWSVWTWEWBJ-ZDLRKIOHSA-M
- common name:
- 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-glucosamine
- Synonym(s):
- β-D-4-deoxy-Δ4-GlcAp-(1→3)-β-D-GlcNAc
- 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-glucose
- 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-glucosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)" cannot be used as a page name in this wiki.