Difference between revisions of "CPD-16491"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * common name: ** 2,6-dia...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) | ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 183.169 | ** 183.169 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine | ||
* Synonym(s): | * Synonym(s): | ||
** N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide | ** N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * REFMET : 2,6-Diamino-4-hydroxy-5-N-methylformamidopyrimidine |
| − | + | ||
| − | + | ||
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=127546 127546] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=127546 127546] | ||
* HMDB : HMDB11657 | * HMDB : HMDB11657 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28643 28643] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04744 C04744] | ||
{{#set: smiles=CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)}} | {{#set: smiles=CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=183.169 }} | {{#set: molecular weight=183.169 }} | ||
| + | {{#set: inchi key=InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine}} | ||
{{#set: common name=N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide}} | {{#set: common name=N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide}} | ||
{{#set: produced by=3.2.2.23-RXN}} | {{#set: produced by=3.2.2.23-RXN}} | ||
Latest revision as of 15:09, 10 January 2019
Contents
Metabolite CPD-16491
- smiles:
- CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
- molecular weight:
- 183.169
- inchi key:
- InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
- common name:
- 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
- Synonym(s):
- N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- REFMET : 2,6-Diamino-4-hydroxy-5-N-methylformamidopyrimidine
- PUBCHEM:
- HMDB : HMDB11657
- CHEBI:
- LIGAND-CPD:
"CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)" cannot be used as a page name in this wiki.
