Difference between revisions of "CPD-15913"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCC12(OC(C)1N(C3(C=CC=CC(C2=O)=3))O)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCC12(OC(C)1N(C3(C=CC=CC(C2=O)=3))O) | ** CC(C)=CCCC(C)=CCCC(C)=CCC12(OC(C)1N(C3(C=CC=CC(C2=O)=3))O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 395.541 | ** 395.541 | ||
+ | * inchi key: | ||
+ | ** InChIKey=FORHHPRBEFTLRM-YEFHWUCQSA-N | ||
+ | * common name: | ||
+ | ** aurachin C epoxide | ||
* Synonym(s): | * Synonym(s): | ||
** 2-hydroxy-1a-methyl-7a-[(2E,6E)-farnesyl]-1a,2-dihydrooxireno[2,3-b]quinolin-7(7aH)-one | ** 2-hydroxy-1a-methyl-7a-[(2E,6E)-farnesyl]-1a,2-dihydrooxireno[2,3-b]quinolin-7(7aH)-one | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-15029]] | * [[RXN-15029]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90889 90889] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90889 90889] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657799 90657799] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C21331 C21331] | ||
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC12(OC(C)1N(C3(C=CC=CC(C2=O)=3))O)}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC12(OC(C)1N(C3(C=CC=CC(C2=O)=3))O)}} | ||
− | |||
− | |||
{{#set: molecular weight=395.541 }} | {{#set: molecular weight=395.541 }} | ||
+ | {{#set: inchi key=InChIKey=FORHHPRBEFTLRM-YEFHWUCQSA-N}} | ||
+ | {{#set: common name=aurachin C epoxide}} | ||
{{#set: common name=2-hydroxy-1a-methyl-7a-[(2E,6E)-farnesyl]-1a,2-dihydrooxireno[2,3-b]quinolin-7(7aH)-one}} | {{#set: common name=2-hydroxy-1a-methyl-7a-[(2E,6E)-farnesyl]-1a,2-dihydrooxireno[2,3-b]quinolin-7(7aH)-one}} | ||
− | |||
{{#set: produced by=RXN-15029}} | {{#set: produced by=RXN-15029}} |
Latest revision as of 15:12, 10 January 2019
Contents
Metabolite CPD-15913
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCC12(OC(C)1N(C3(C=CC=CC(C2=O)=3))O)
- molecular weight:
- 395.541
- inchi key:
- InChIKey=FORHHPRBEFTLRM-YEFHWUCQSA-N
- common name:
- aurachin C epoxide
- Synonym(s):
- 2-hydroxy-1a-methyl-7a-[(2E,6E)-farnesyl]-1a,2-dihydrooxireno[2,3-b]quinolin-7(7aH)-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"2-hydroxy-1a-methyl-7a-[(2E,6E)-farnesyl]-1a,2-dihydrooxireno[2,3-b]quinolin-7(7aH)-one" cannot be used as a page name in this wiki.