Difference between revisions of "CPD0-1074"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1074 CPD0-1074] == * smiles: ** C(P([O-])(=O)[O-])[N+] * common name: ** (aminomethyl)phos...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(P([O-])(=O)[O-])[N+] | ** C(P([O-])(=O)[O-])[N+] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 110.029 | ** 110.029 | ||
| + | * inchi key: | ||
| + | ** InChIKey=MGRVRXRGTBOSHW-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** aminomethylphosphonate | ||
* Synonym(s): | * Synonym(s): | ||
** AMPA | ** AMPA | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133674 133674] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203092 25203092] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203092 25203092] | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11033 C11033] | ** [http://www.genome.jp/dbget-bin/www_bget?C11033 C11033] | ||
{{#set: smiles=C(P([O-])(=O)[O-])[N+]}} | {{#set: smiles=C(P([O-])(=O)[O-])[N+]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=110.029 }} | {{#set: molecular weight=110.029 }} | ||
| + | {{#set: inchi key=InChIKey=MGRVRXRGTBOSHW-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=aminomethylphosphonate}} | ||
{{#set: common name=AMPA}} | {{#set: common name=AMPA}} | ||
{{#set: produced by=RXN-17951}} | {{#set: produced by=RXN-17951}} | ||
Latest revision as of 15:18, 10 January 2019
Contents
Metabolite CPD0-1074
- smiles:
- C(P([O-])(=O)[O-])[N+]
- molecular weight:
- 110.029
- inchi key:
- InChIKey=MGRVRXRGTBOSHW-UHFFFAOYSA-M
- common name:
- aminomethylphosphonate
- Synonym(s):
- AMPA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(P([O-])(=O)[O-])[N+" cannot be used as a page name in this wiki.
