Difference between revisions of "CPD-9700"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * common na...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) | ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 269.277 | ** 269.277 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M | ||
| + | * common name: | ||
| + | ** hypoglycin B | ||
* Synonym(s): | * Synonym(s): | ||
** hypoglycine B | ** hypoglycine B | ||
| Line 23: | Line 23: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135] | ||
* HMDB : HMDB29428 | * HMDB : HMDB29428 | ||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280] | ** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280] | ||
| + | * Wikipedia : Hypoglycin_B | ||
{{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}} | {{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=269.277 }} | {{#set: molecular weight=269.277 }} | ||
| + | {{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}} | ||
| + | {{#set: common name=hypoglycin B}} | ||
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}} | {{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}} | ||
{{#set: produced by=RXN-9157}} | {{#set: produced by=RXN-9157}} | ||
Latest revision as of 15:24, 10 January 2019
Contents
Metabolite CPD-9700
- smiles:
- C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
- molecular weight:
- 269.277
- inchi key:
- InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
- common name:
- hypoglycin B
- Synonym(s):
- hypoglycine B
- L-gamma-glutamyl-L-hypoglycin
- γ-glutamyl-β-(methylenecyclopropyl)-alanine
- (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)" cannot be used as a page name in this wiki.
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}
