Difference between revisions of "CPD-16953"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * common name: ** 2-a...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) | ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 223.234 | ** 223.234 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N | ||
| + | * common name: | ||
| + | ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804] | ||
{{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}} | {{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=223.234 }} | {{#set: molecular weight=223.234 }} | ||
| + | {{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}} | ||
| + | {{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}} | ||
{{#set: consumed by=RXN-15733}} | {{#set: consumed by=RXN-15733}} | ||
Latest revision as of 15:27, 10 January 2019
Contents
Metabolite CPD-16953
- smiles:
- CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
- molecular weight:
- 223.234
- inchi key:
- InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
- common name:
- 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" cannot be used as a page name in this wiki.
