Difference between revisions of "CPD-15125"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * smiles: ** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-] * common name: ** 2,4-dih...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-] | ** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 188.137 | ** 188.137 | ||
+ | * inchi key: | ||
+ | ** InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L | ||
+ | * common name: | ||
+ | ** 2,4-dihydroxyhept-2-enedioate | ||
* Synonym(s): | * Synonym(s): | ||
Line 16: | Line 16: | ||
* [[RXN-14146]] | * [[RXN-14146]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58936 58936] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58936 58936] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54724344 54724344] | ||
+ | * GO-TERMS : (REFMET "2,4-dihydroxy-2-heptenedioc acid" NIL midford 3701443689 NIL NIL) | ||
{{#set: smiles=C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]}} | {{#set: smiles=C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=188.137 }} | {{#set: molecular weight=188.137 }} | ||
+ | {{#set: inchi key=InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L}} | ||
+ | {{#set: common name=2,4-dihydroxyhept-2-enedioate}} | ||
{{#set: reversible reaction associated=RXN-14146}} | {{#set: reversible reaction associated=RXN-14146}} |
Latest revision as of 16:27, 10 January 2019
Contents
Metabolite CPD-15125
- smiles:
- C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]
- molecular weight:
- 188.137
- inchi key:
- InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L
- common name:
- 2,4-dihydroxyhept-2-enedioate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
- PUBCHEM:
- GO-TERMS : (REFMET "2,4-dihydroxy-2-heptenedioc acid" NIL midford 3701443689 NIL NIL)
"C(=O)([O-])CCC(O)C=C(O)C(=O)[O-" cannot be used as a page name in this wiki.