Difference between revisions of "DEAMIDO-NAD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O) | ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 662.399 | ** 662.399 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L | ||
| + | * common name: | ||
| + | ** nicotinate adenine dinucleotide | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** deamino-NAD+ |
** NaADN | ** NaADN | ||
** deamido-NAD+ | ** deamido-NAD+ | ||
** deamidonicotinamide adenine dinucleoetide | ** deamidonicotinamide adenine dinucleoetide | ||
** deamido-NAD | ** deamido-NAD | ||
| − | ** | + | ** NaAD |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[NAD-SYNTH-GLN-RXN]] | * [[NAD-SYNTH-GLN-RXN]] | ||
| + | * [[NAD-SYNTH-NH3-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[NICONUCADENYLYLTRAN-RXN]] | * [[NICONUCADENYLYLTRAN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646] | ||
| − | * | + | * DRUGBANK : DB04099 |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437] | ||
| + | * CAS : 6450-77-7 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00857 C00857] | ||
| + | * HMDB : HMDB01179 | ||
* BIGG : dnad | * BIGG : dnad | ||
{{#set: smiles=C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)}} | {{#set: smiles=C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=662.399 }} | {{#set: molecular weight=662.399 }} | ||
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L}} |
| − | {{#set: consumed by=NAD-SYNTH- | + | {{#set: common name=nicotinate adenine dinucleotide}} |
| + | {{#set: common name=deamino-NAD+|NaADN|deamido-NAD+|deamidonicotinamide adenine dinucleoetide|deamido-NAD|NaAD}} | ||
| + | {{#set: consumed by=NAD-SYNTH-GLN-RXN|NAD-SYNTH-NH3-RXN}} | ||
{{#set: produced by=NICONUCADENYLYLTRAN-RXN}} | {{#set: produced by=NICONUCADENYLYLTRAN-RXN}} | ||
Latest revision as of 15:28, 10 January 2019
Contents
Metabolite DEAMIDO-NAD
- smiles:
- C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)
- molecular weight:
- 662.399
- inchi key:
- InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L
- common name:
- nicotinate adenine dinucleotide
- Synonym(s):
- deamino-NAD+
- NaADN
- deamido-NAD+
- deamidonicotinamide adenine dinucleoetide
- deamido-NAD
- NaAD
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- DRUGBANK : DB04099
- CHEBI:
- CAS : 6450-77-7
- LIGAND-CPD:
- HMDB : HMDB01179
- BIGG : dnad
"C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)" cannot be used as a page name in this wiki.
