Difference between revisions of "CPD-596"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] == * smiles: ** CN(C(=[N+])NCCCC([N+])C(=O)[O-])C * common name: ** N6,N6-dime...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CN(C(=[N+])NCCCC([N+])C(=O)[O-])C | ** CN(C(=[N+])NCCCC([N+])C(=O)[O-])C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 203.264 | ** 203.264 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O | ||
| + | * common name: | ||
| + | ** N6,N6-dimethyl-L-arginine | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DIMETHYLARGININASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203330 25203330] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203330 25203330] | ||
| − | * | + | * REFMET : Dimethylarginine |
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58326 58326] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58326 58326] | ||
| + | * CAS : 102783-24-4 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03626 C03626] | ** [http://www.genome.jp/dbget-bin/www_bget?C03626 C03626] | ||
| + | * HMDB : HMDB01539 | ||
{{#set: smiles=CN(C(=[N+])NCCCC([N+])C(=O)[O-])C}} | {{#set: smiles=CN(C(=[N+])NCCCC([N+])C(=O)[O-])C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=203.264 }} | {{#set: molecular weight=203.264 }} | ||
| − | {{#set: | + | {{#set: inchi key=InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O}} |
| + | {{#set: common name=N6,N6-dimethyl-L-arginine}} | ||
| + | {{#set: consumed by=DIMETHYLARGININASE-RXN}} | ||
Latest revision as of 15:30, 10 January 2019
Contents
Metabolite CPD-596
- smiles:
- CN(C(=[N+])NCCCC([N+])C(=O)[O-])C
- molecular weight:
- 203.264
- inchi key:
- InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O
- common name:
- N6,N6-dimethyl-L-arginine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- REFMET : Dimethylarginine
- CHEBI:
- CAS : 102783-24-4
- LIGAND-CPD:
- HMDB : HMDB01539
"CN(C(=[N+])NCCCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.
