Difference between revisions of "CPD-14601"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * c...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) | ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 319.333 | ** 319.333 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M | ||
| + | * common name: | ||
| + | ** mycophenolate | ||
* Synonym(s): | * Synonym(s): | ||
** mycophenolic acid | ** mycophenolic acid | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995] | ||
{{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}} | {{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=319.333 }} | {{#set: molecular weight=319.333 }} | ||
| + | {{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}} | ||
| + | {{#set: common name=mycophenolate}} | ||
{{#set: common name=mycophenolic acid}} | {{#set: common name=mycophenolic acid}} | ||
{{#set: consumed by=RXN-13608|RXN-13607}} | {{#set: consumed by=RXN-13608|RXN-13607}} | ||
{{#set: produced by=RXN-13605}} | {{#set: produced by=RXN-13605}} | ||
Latest revision as of 11:14, 10 January 2019
Contents
Metabolite CPD-14601
- smiles:
- CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
- molecular weight:
- 319.333
- inchi key:
- InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
- common name:
- mycophenolate
- Synonym(s):
- mycophenolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)" cannot be used as a page name in this wiki.
