Difference between revisions of "CPD-10660"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10660 CPD-10660] == * smiles: ** C(=O)C1(C=CC=C(Cl)C=1) * common name: ** 3-chlorobenzaldeh...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)C1(C=CC=C(Cl)C=1) | ** C(=O)C1(C=CC=C(Cl)C=1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 140.569 | ** 140.569 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SRWILAKSARHZPR-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 3-chlorobenzaldehyde | ||
* Synonym(s): | * Synonym(s): | ||
Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.15087912.html 15087912] | ** [http://www.chemspider.com/Chemical-Structure.15087912.html 15087912] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11477 11477] | ||
{{#set: smiles=C(=O)C1(C=CC=C(Cl)C=1)}} | {{#set: smiles=C(=O)C1(C=CC=C(Cl)C=1)}} | ||
− | |||
− | |||
{{#set: molecular weight=140.569 }} | {{#set: molecular weight=140.569 }} | ||
+ | {{#set: inchi key=InChIKey=SRWILAKSARHZPR-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=3-chlorobenzaldehyde}} | ||
{{#set: consumed by=RXN-9910}} | {{#set: consumed by=RXN-9910}} |
Latest revision as of 11:32, 10 January 2019
Contents
Metabolite CPD-10660
- smiles:
- C(=O)C1(C=CC=C(Cl)C=1)
- molecular weight:
- 140.569
- inchi key:
- InChIKey=SRWILAKSARHZPR-UHFFFAOYSA-N
- common name:
- 3-chlorobenzaldehyde
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links