Difference between revisions of "CPD-323"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 384.644 | ** 384.644 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N | ||
+ | * common name: | ||
+ | ** cholest-4-en-3-one | ||
* Synonym(s): | * Synonym(s): | ||
** cholestenone | ** cholestenone | ||
Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]] | ||
* [[RXN-12848]] | * [[RXN-12848]] | ||
* [[RXN-17644]] | * [[RXN-17644]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.82602.html 82602] | ** [http://www.chemspider.com/Chemical-Structure.82602.html 82602] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91477 91477] | ||
+ | * REFMET : Cholestenone | ||
+ | * LIPID_MAPS : LMST01010015 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16175 16175] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16175 16175] | ||
+ | * CAS : 601-57-0 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00599 C00599] | ||
+ | * HMDB : HMDB00921 | ||
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
− | |||
− | |||
{{#set: molecular weight=384.644 }} | {{#set: molecular weight=384.644 }} | ||
+ | {{#set: inchi key=InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N}} | ||
+ | {{#set: common name=cholest-4-en-3-one}} | ||
{{#set: common name=cholestenone|4-cholesten-3-one|4-cholestene-3-one}} | {{#set: common name=cholestenone|4-cholesten-3-one|4-cholestene-3-one}} | ||
− | {{#set: consumed by | + | {{#set: consumed by=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN|RXN-12848|RXN-17644}} |
− | + |
Latest revision as of 11:45, 10 January 2019
Contents
Metabolite CPD-323
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 384.644
- inchi key:
- InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N
- common name:
- cholest-4-en-3-one
- Synonym(s):
- cholestenone
- 4-cholesten-3-one
- 4-cholestene-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEMSPIDER:
- PUBCHEM:
- REFMET : Cholestenone
- LIPID_MAPS : LMST01010015
- CHEBI:
- CAS : 601-57-0
- LIGAND-CPD:
- HMDB : HMDB00921
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.