Difference between revisions of "CPD-9096"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9096 CPD-9096] == * smiles: ** CCC5(C4(=CC6(=C(C)C1(=C(C([C-](C(=O)OC)C(=O)1)=C2(C(CCC(OCC=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC5(C4(=CC6(=C(C)C1(=C(C([C-](C(=O)OC)C(=O)1)=C2(C(CCC(OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)=O)C(C)C(=N2)C=C3(C(C)=C(C(C)=O)C(N3)=CC(=N4)C(C)5)))N6)))) | ** CCC5(C4(=CC6(=C(C)C1(=C(C([C-](C(=O)OC)C(=O)1)=C2(C(CCC(OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)=O)C(C)C(=N2)C=C3(C(C)=C(C(C)=O)C(N3)=CC(=N4)C(C)5)))N6)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 888.221 | ** 888.221 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QGUDPQYOMULITA-ZASYKXLDSA-N | ||
| + | * common name: | ||
| + | ** bacteriopheophytin a | ||
* Synonym(s): | * Synonym(s): | ||
** bacteriophaeophytin a | ** bacteriophaeophytin a | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[RXN-8796]] | * [[RXN-8796]] | ||
| + | * [[RXN-17427]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706063 122706063] |
{{#set: smiles=CCC5(C4(=CC6(=C(C)C1(=C(C([C-](C(=O)OC)C(=O)1)=C2(C(CCC(OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)=O)C(C)C(=N2)C=C3(C(C)=C(C(C)=O)C(N3)=CC(=N4)C(C)5)))N6))))}} | {{#set: smiles=CCC5(C4(=CC6(=C(C)C1(=C(C([C-](C(=O)OC)C(=O)1)=C2(C(CCC(OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)=O)C(C)C(=N2)C=C3(C(C)=C(C(C)=O)C(N3)=CC(=N4)C(C)5)))N6))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=888.221 }} | {{#set: molecular weight=888.221 }} | ||
| + | {{#set: inchi key=InChIKey=QGUDPQYOMULITA-ZASYKXLDSA-N}} | ||
| + | {{#set: common name=bacteriopheophytin a}} | ||
{{#set: common name=bacteriophaeophytin a}} | {{#set: common name=bacteriophaeophytin a}} | ||
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-8796|RXN-17427}} |
Latest revision as of 11:46, 10 January 2019
Contents
Metabolite CPD-9096
- smiles:
- CCC5(C4(=CC6(=C(C)C1(=C(C([C-](C(=O)OC)C(=O)1)=C2(C(CCC(OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)=O)C(C)C(=N2)C=C3(C(C)=C(C(C)=O)C(N3)=CC(=N4)C(C)5)))N6))))
- molecular weight:
- 888.221
- inchi key:
- InChIKey=QGUDPQYOMULITA-ZASYKXLDSA-N
- common name:
- bacteriopheophytin a
- Synonym(s):
- bacteriophaeophytin a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC5(C4(=CC6(=C(C)C1(=C(C([C-](C(=O)OC)C(=O)1)=C2(C(CCC(OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)=O)C(C)C(=N2)C=C3(C(C)=C(C(C)=O)C(N3)=CC(=N4)C(C)5)))N6))))" cannot be used as a page name in this wiki.
