Difference between revisions of "CPD-11525"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == | ||
* smiles: | * smiles: | ||
| − | ** CCC= | + | ** CCC=CCC1(C(CCC(=O)1)CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 983.813 | ** 983.813 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YYUZYSVPFVOYLB-RGUWMICCSA-J | ||
| + | * common name: | ||
| + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** OPC4-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 18: | Line 19: | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126961074 126961074] |
| − | {{#set: smiles=CCC= | + | {{#set: smiles=CCC=CCC1(C(CCC(=O)1)CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])}} |
| − | + | ||
| − | + | ||
{{#set: molecular weight=983.813 }} | {{#set: molecular weight=983.813 }} | ||
| + | {{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-RGUWMICCSA-J}} | ||
| + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA}} | ||
| + | {{#set: common name=OPC4-CoA}} | ||
{{#set: consumed by=RXN-10707}} | {{#set: consumed by=RXN-10707}} | ||
{{#set: produced by=RXN-10700}} | {{#set: produced by=RXN-10700}} | ||
Latest revision as of 11:47, 10 January 2019
Contents
Metabolite CPD-11525
- smiles:
- CCC=CCC1(C(CCC(=O)1)CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])
- molecular weight:
- 983.813
- inchi key:
- InChIKey=YYUZYSVPFVOYLB-RGUWMICCSA-J
- common name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-CoA
- Synonym(s):
- OPC4-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC1(C(CCC(=O)1)CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])" cannot be used as a page name in this wiki.
